Rvn138

CAS

941104-13-8

Catalog Number

ACM941104138

Category

Other Products

Molecular Weight

389.453

Molecular Formula

C₂₃H₂₃N₃O₃

If you have any other questions or need other size, please get a quote.

What is the PubChem CID of the compound?

The PubChem CID of the compound is 8125513.

What is the molecular formula of the compound?

The molecular formula of the compound is C23H23N3O3.

What are the synonyms of the compound?

The synonyms of the compound are 941104-13-8, 1-(4-(4-(5-methyl-3-phenylisoxazole-4-carbonyl)piperazin-1-yl)phenyl)ethanone, RVN138, DTXSID40429079, AKOS034110482.

What is the molecular weight of the compound?

The molecular weight of the compound is 389.4 g/mol.

When was the compound created?

The compound was created on July 30, 2006.

When was the compound last modified?

The compound was last modified on December 30, 2023.

What is the IUPAC Name of the compound?

The IUPAC Name of the compound is 1-[4-[4-(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)piperazin-1-yl]phenyl]ethanone.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C23H23N3O3/c1-16(27)18-8-10-20(11-9-18)25-12-14-26(15-13-25)23(28)21-17(2)29-24-22(21)19-6-4-3-5-7-19/h3-11H,12-15H2,1-2H3.

What is the InChIKey of the compound?

The InChIKey of the compound is SJLCJQHGHCDQQF-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)N3CCN(CC3)C4=CC=C(C=C4)C(=O)C.

Recommended Products