What is the molecular formula of Thiocyanic acid, 1-methyl-3-(triethoxysilyl)propyl ester?
The molecular formula is C11H23NO3SSi.
What is the molecular weight of Thiocyanic acid, 1-methyl-3-(triethoxysilyl)propyl ester?
The molecular weight is 277.46 g/mol.
What is the IUPAC Name of Thiocyanic acid, 1-methyl-3-(triethoxysilyl)propyl ester?
The IUPAC Name is 4-triethoxysilylbutan-2-yl thiocyanate.
What is the InChIKey of Thiocyanic acid, 1-methyl-3-(triethoxysilyl)propyl ester?
The InChIKey is CSNCCNLXNYETHP-UHFFFAOYSA-N.
What is the Canonical SMILES of Thiocyanic acid, 1-methyl-3-(triethoxysilyl)propyl ester?
The Canonical SMILES is CCO[Si](CCC(C)SC#N)(OCC)OCC.
What is the CAS number of Thiocyanic acid, 1-methyl-3-(triethoxysilyl)propyl ester?
The CAS number is 94087-37-3.
How many Hydrogen Bond Acceptor Count does Thiocyanic acid, 1-methyl-3-(triethoxysilyl)propyl ester have?
It has 5 Hydrogen Bond Acceptor Count.
What is the Exact Mass of Thiocyanic acid, 1-methyl-3-(triethoxysilyl)propyl ester?
The Exact Mass is 277.11679130 g/mol.
How many Rotatable Bond Count does Thiocyanic acid, 1-methyl-3-(triethoxysilyl)propyl ester have?
It has 10 Rotatable Bond Count.
Is the Compound Is Canonicalized for Thiocyanic acid, 1-methyl-3-(triethoxysilyl)propyl ester?
Yes, the Compound Is Canonicalized.