What is the molecular formula of 1,3-Dibromo-1,2,3,4-tetrahydronaphthalene?
The molecular formula is C10H10Br2.
When was 1,3-Dibromo-1,2,3,4-tetrahydronaphthalene created and modified in PubChem?
It was created on 2005-08-08 and last modified on 2023-12-30.
What is the IUPAC name of 1,3-Dibromo-1,2,3,4-tetrahydronaphthalene?
The IUPAC name is 1,3-dibromo-1,2,3,4-tetrahydronaphthalene.
What is the InChI of 1,3-Dibromo-1,2,3,4-tetrahydronaphthalene?
The InChI is InChI=1S/C10H10Br2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1-4,8,10H,5-6H2.
What is the InChIKey of 1,3-Dibromo-1,2,3,4-tetrahydronaphthalene?
The InChIKey is VUDWWNGBDAJKFX-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 1,3-Dibromo-1,2,3,4-tetrahydronaphthalene have?
It has 0 hydrogen bond donor counts.
What is the exact mass of 1,3-Dibromo-1,2,3,4-tetrahydronaphthalene?
The exact mass is 289.91288 g/mol.
What is the topological polar surface area of 1,3-Dibromo-1,2,3,4-tetrahydronaphthalene?
The topological polar surface area is 0.2.
How many defined atom stereocenter counts does 1,3-Dibromo-1,2,3,4-tetrahydronaphthalene have?
It has 0 defined atom stereocenter counts.
Is 1,3-Dibromo-1,2,3,4-tetrahydronaphthalene a canonicalized compound?
Yes, it is a canonicalized compound.