940364-46-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 4-(4-benzylpiperazin-1-yl)benzoic acid.
The InChI of the compound is InChI=1S/C18H20N2O2/c21-18(22)16-6-8-17(9-7-16)20-12-10-19(11-13-20)14-15-4-2-1-3-5-15/h1-9H,10-14H2,(H,21,22).
The InChIKey of the compound is HLZACPQJCRXAQY-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CN(CCN1CC2=CC=CC=C2)C3=CC=C(C=C3)C(=O)O.
The molecular weight of the compound is 296.4 g/mol.
The XLogP3-AA value of the compound is 0.6.
The compound has 1 hydrogen bond donor count.
The compound has 4 hydrogen bond acceptor count.
The compound has 4 rotatable bond count.
Yes, the compound is canonicalized.