What is the molecular formula of allyl 2-O-acetyl-3-O-benzyl-alpha-L-rhamnopyranoside?
The molecular formula is C18H24O6.
When was allyl 2-O-acetyl-3-O-benzyl-alpha-L-rhamnopyranoside created and modified?
It was created on 2007-09-03 and modified on 2023-12-30.
What is the molecular weight of allyl 2-O-acetyl-3-O-benzyl-alpha-L-rhamnopyranoside?
The molecular weight is 336.4 g/mol.
What is the IUPAC name of allyl 2-O-acetyl-3-O-benzyl-alpha-L-rhamnopyranoside?
The IUPAC name is [(2R,3R,4R,5S,6S)-5-hydroxy-6-methyl-4-phenylmethoxy-2-prop-2-enoxyoxan-3-yl] acetate.
What is the InChI of allyl 2-O-acetyl-3-O-benzyl-alpha-L-rhamnopyranoside?
The InChI is InChI=1S/C18H24O6/c1-4-10-21-18-17(24-13(3)19)16(15(20)12(2)23-18)22-11-14-8-6-5-7-9-14/h4-9,12,15-18,20H,1,10-11H2,2-3H3/t12-,15-,16+,17+,18+/m0/s1.
What is the InChIKey of allyl 2-O-acetyl-3-O-benzyl-alpha-L-rhamnopyranoside?
The InChIKey is VKYNKOPEBGEDAP-KMJFJPQNSA-N.
How many hydrogen bond donor counts does allyl 2-O-acetyl-3-O-benzyl-alpha-L-rhamnopyranoside have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of allyl 2-O-acetyl-3-O-benzyl-alpha-L-rhamnopyranoside?
The topological polar surface area is 74.2Å2.
How many defined atom stereocenter counts does allyl 2-O-acetyl-3-O-benzyl-alpha-L-rhamnopyranoside have?
It has 5 defined atom stereocenter counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.