What is the molecular formula of 3-[2-(trifluoromethyl)phenyl]propanoic acid?
The molecular formula is C10H9F3O2.
What is the molecular weight of 3-[2-(trifluoromethyl)phenyl]propanoic acid?
The molecular weight is 218.17 g/mol.
What are some synonyms for 3-[2-(trifluoromethyl)phenyl]propanoic acid?
Some synonyms include 3-[2-(trifluoromethyl)phenyl]propionic acid and 2-(trifluoromethyl)hydrocinnamic acid.
When was the compound created and last modified?
It was created on 2007-02-09 and last modified on 2023-12-30.
What is the IUPAC name of 3-[2-(trifluoromethyl)phenyl]propanoic acid?
The IUPAC name is 3-[2-(trifluoromethyl)phenyl]propanoic acid.
What is the InChIKey of 3-[2-(trifluoromethyl)phenyl]propanoic acid?
The InChIKey is YTDVNFDGHHHPEE-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 3-[2-(trifluoromethyl)phenyl]propanoic acid?
The Canonical SMILES is C1=CC=C(C(=C1)CCC(=O)O)C(F)(F)F.
What is the CAS number for 3-[2-(trifluoromethyl)phenyl]propanoic acid?
The CAS number is 94022-99-8.
What is the XLogP3-AA value for 3-[2-(trifluoromethyl)phenyl]propanoic acid?
The XLogP3-AA value is 2.6.
How many hydrogen bond acceptors does 3-[2-(trifluoromethyl)phenyl]propanoic acid have?
It has 5 hydrogen bond acceptors.