What is the molecular formula of 3-Chloro-4-(dibutylamino)benzenediazonium trichlorozincate?
The molecular formula is C14H21Cl4N3Zn.
What is the molecular weight of 3-Chloro-4-(dibutylamino)benzenediazonium trichlorozincate?
The molecular weight is 438.5 g/mol.
When was 3-Chloro-4-(dibutylamino)benzenediazonium trichlorozincate created and modified in PubChem?
It was created on 2009-08-20 and last modified on 2023-12-30.
What is the IUPAC name of 3-Chloro-4-(dibutylamino)benzenediazonium trichlorozincate?
The IUPAC name is 3-chloro-4-(dibutylamino)benzenediazonium;trichlorozinc(1-).
What is the InChIKey of 3-Chloro-4-(dibutylamino)benzenediazonium trichlorozincate?
The InChIKey is KYRCKTSELNEPKH-UHFFFAOYSA-K.
What is the canonical SMILES representation of 3-Chloro-4-(dibutylamino)benzenediazonium trichlorozincate?
The canonical SMILES is CCCCN(CCCC)C1=C(C=C(C=C1)[N+]#N)Cl.Cl[Zn-](Cl)Cl.
What is the CAS number of 3-Chloro-4-(dibutylamino)benzenediazonium trichlorozincate?
The CAS number is 94022-54-5.
How many hydrogen bond acceptor counts are there in 3-Chloro-4-(dibutylamino)benzenediazonium trichlorozincate?
There are 3 hydrogen bond acceptor counts.
What is the topological polar surface area of 3-Chloro-4-(dibutylamino)benzenediazonium trichlorozincate?
The topological polar surface area is 31.4 Å^2.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.