CAS
94021-55-3 Purity
---
94021-55-3 Purity
---
![Pentasodium bis[3-hydroxy-4-[(2-hydroxy-6-sulfo-1-naphthyl)azo]-7-nitronaphthalene-1-sulfonato(4-)]chromate(5-)](https://resource.alfa-chemistry.com/structure/94021-56-4.gif)
Inquiry Basket
3a,4,5,6,7,7a-Hexahydrodimethyl-4,7-methano-1H-indenemethanol
CAS
94021-61-1
Catalog Number
ACM94021611
Category
Other Products
Molecular Formula
C13H20O
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3a,4,5,6,7,7a-Hexahydrodimethyl-4,7-methano-1H-indenemethanol?
The molecular formula is C13H20O.
When was 3a,4,5,6,7,7a-Hexahydrodimethyl-4,7-methano-1H-indenemethanol created?
It was created on 2009-08-20.
What is the IUPAC name of 3a,4,5,6,7,7a-Hexahydrodimethyl-4,7-methano-1H-indenemethanol?
The IUPAC name is (4,5-dimethyl-3-tricyclo[5.2.1.0 2,6 ]dec-4-enyl)methanol.
What is the Canonical SMILES of 3a,4,5,6,7,7a-Hexahydrodimethyl-4,7-methano-1H-indenemethanol?
The Canonical SMILES is CC1=C(C2C3CCC(C3)C2C1CO).
What is the molecular weight of 3a,4,5,6,7,7a-Hexahydrodimethyl-4,7-methano-1H-indenemethanol?
The molecular weight is 192.30 g/mol.
How many hydrogen bond donor counts does 3a,4,5,6,7,7a-Hexahydrodimethyl-4,7-methano-1H-indenemethanol have?
It has 1 hydrogen bond donor count.
What is the XLogP3-AA value for 3a,4,5,6,7,7a-Hexahydrodimethyl-4,7-methano-1H-indenemethanol?
The XLogP3-AA value is 2.1.
What is the exact mass of 3a,4,5,6,7,7a-Hexahydrodimethyl-4,7-methano-1H-indenemethanol?
The exact mass is 192.151415257 g/mol.
How many heavy atoms are present in 3a,4,5,6,7,7a-Hexahydrodimethyl-4,7-methano-1H-indenemethanol?
There are 14 heavy atoms.
Is 3a,4,5,6,7,7a-Hexahydrodimethyl-4,7-methano-1H-indenemethanol a canonicalized compound?
Yes, the compound is canonicalized.
Recommended Products
![Pentahydrogen bis[3-hydroxy-4-[(2-hydroxy-6-sulfo-1-naphthyl)azo]-7-nitronaphthalene-1-sulfonato(4-)]chromate(3-)](https://resource.alfa-chemistry.com/structure/94021-55-3.gif)
![Octahydrodimethyl-2,5-methano-2H-indeno[1,2-b]oxirene](https://resource.alfa-chemistry.com/structure/94021-60-0.gif)
