What is the molecular formula of Methyl 2-[[(4-methoxyphenyl)methylene]amino]benzoate?
The molecular formula is C16H15NO3.
What are some synonyms for Methyl 2-[[(4-methoxyphenyl)methylene]amino]benzoate?
Synonyms include 14735-72-9, 93983-63-2, and METHYL 2-[[[4-METHOXYPHENYL)METHYLENE]AMINO]BENZOATE.
What is the computed molecular weight of Methyl 2-[[(4-methoxyphenyl)methylene]amino]benzoate?
The computed molecular weight is 269.29 g/mol.
What is the IUPAC Name of Methyl 2-[[4-methoxyphenyl)methylideneamino]benzoate?
The IUPAC Name is methyl 2-[(4-methoxyphenyl)methylideneamino]benzoate.
What is the Canonical SMILES representation of Methyl 2-[[(4-methoxyphenyl)methylene]amino]benzoate?
The Canonical SMILES representation is COC1=CC=C(C=C1)C=NC2=CC=CC=C2C(=O)OC.
What is the InChIKey of Methyl 2-[[(4-methoxyphenyl)methylene]amino]benzoate?
The InChIKey is VYSXJKIBCGUXTM-UHFFFAOYSA-N.
How many hydrogen bond acceptors are there in Methyl 2-[[(4-methoxyphenyl)methylene]amino]benzoate?
There are 4 hydrogen bond acceptors in Methyl 2-[[(4-methoxyphenyl)methylene]amino]benzoate.
What is the topological polar surface area of Methyl 2-[[(4-methoxyphenyl)methylene]amino]benzoate?
The topological polar surface area is 47.9 Å2.
How many rotatable bond counts are there in Methyl 2-[[(4-methoxyphenyl)methylene]amino]benzoate?
There are 5 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.