What is the molecular formula of Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate?
The molecular formula is C10H8F4O3.
What is the molecular weight of Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate?
The molecular weight is 252.16 g/mol.
What is the IUPAC name of Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate?
The IUPAC name is methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate.
What is the InChI of Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate?
The InChI is InChI=1S/C10H8F4O3/c1-16-8(15)6-2-4-7(5-3-6)17-10(13,14)9(11)12/h2-5,9H,1H3.
What is the InChIKey of Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate?
The InChIKey is XBSLEPDQBBJDSJ-UHFFFAOYSA-N.
What is the Canonical SMILES of Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate?
The Canonical SMILES is COC(=O)C1=CC=C(C=C1)OC(C(F)F)(F)F.
What is the CAS number of Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate?
The CAS number is 93982-47-9.
How many hydrogen bond acceptors are present in Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate?
There are 7 hydrogen bond acceptors.
What is the topological polar surface area of Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate?
The topological polar surface area is 35.5 Å2.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.