What is the molecular formula of 3-Hydroxy-2,2-bis[[(1-oxoallyl)oxy]methyl]propyl aziridine-1-propionate?
The molecular formula is C16H23NO7.
What is the molecular weight of 3-Hydroxy-2,2-bis[[(1-oxoallyl)oxy]methyl]propyl aziridine-1-propionate?
The molecular weight is 341.36 g/mol.
When was 3-Hydroxy-2,2-bis[[(1-oxoallyl)oxy]methyl]propyl aziridine-1-propionate created and last modified in the database?
It was created on August 20, 2009, and last modified on December 30, 2023.
What is the IUPAC Name of 3-Hydroxy-2,2-bis[[(1-oxoallyl)oxy]methyl]propyl aziridine-1-propionate?
[2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] 3-(aziridin-1-yl)propanoate.
What is the InChIKey of 3-Hydroxy-2,2-bis[[(1-oxoallyl)oxy]methyl]propyl aziridine-1-propionate?
The InChIKey is GVBDDZNAFQDZPW-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 3-Hydroxy-2,2-bis[[(1-oxoallyl)oxy]methyl]propyl aziridine-1-propionate?
C=CC(=O)OCC(CO)(COC(=O)CCN1CC1)COC(=O)C=C.
How many hydrogen bond acceptor counts does 3-Hydroxy-2,2-bis[[(1-oxoallyl)oxy]methyl]propyl aziridine-1-propionate have?
It has 8 hydrogen bond acceptor counts.
What is the topological polar surface area of 3-Hydroxy-2,2-bis[[(1-oxoallyl)oxy]methyl]propyl aziridine-1-propionate?
The topological polar surface area is 102 Ų.
How many rotatable bond counts does 3-Hydroxy-2,2-bis[[(1-oxoallyl)oxy]methyl]propyl aziridine-1-propionate have?
It has 15 rotatable bond counts.
What is the formal charge of 3-Hydroxy-2,2-bis[[(1-oxoallyl)oxy]methyl]propyl aziridine-1-propionate?
The formal charge is 0.