What is the molecular formula of Potassium N-(4-chloro-6-methoxy-m-tolyl)-3-hydroxynaphthalene-2-carboxamidate?
The molecular formula is C19H15ClKNO3.
When was Potassium N-(4-chloro-6-methoxy-m-tolyl)-3-hydroxynaphthalene-2-carboxamidate created and modified?
It was created on 2009-08-20 and modified on 2023-12-30.
What is the IUPAC name of Potassium N-(4-chloro-6-methoxy-m-tolyl)-3-hydroxynaphthalene-2-carboxamidate?
The IUPAC name is potassium;3-[(4-chloro-2-methoxy-5-methylphenyl)carbamoyl]naphthalen-2-olate.
What is the molecular weight of Potassium N-(4-chloro-6-methoxy-m-tolyl)-3-hydroxynaphthalene-2-carboxamidate?
The molecular weight is 379.9 g/mol.
What is the Canonical SMILES of Potassium N-(4-chloro-6-methoxy-m-tolyl)-3-hydroxynaphthalene-2-carboxamidate?
CC1=CC(=C(C=C1Cl)OC)NC(=O)C2=CC3=CC=CC=C3C=C2[O-].[K+]
What is the Hydrogen Bond Acceptor Count of Potassium N-(4-chloro-6-methoxy-m-tolyl)-3-hydroxynaphthalene-2-carboxamidate?
The Hydrogen Bond Acceptor Count is 3.
What is the Heavy Atom Count of Potassium N-(4-chloro-6-methoxy-m-tolyl)-3-hydroxynaphthalene-2-carboxamidate?
The Heavy Atom Count is 25.
What is the Formal Charge of Potassium N-(4-chloro-6-methoxy-m-tolyl)-3-hydroxynaphthalene-2-carboxamidate?
The Formal Charge is 0.
Is Potassium N-(4-chloro-6-methoxy-m-tolyl)-3-hydroxynaphthalene-2-carboxamidate considered canonicalized?
Yes, the compound is canonicalized.
What is the CAS number and European Community (EC) Number of Potassium N-(4-chloro-6-methoxy-m-tolyl)-3-hydroxynaphthalene-2-carboxamidate?
The CAS number is 93964-24-0, and the EC Number is 300-873-0.