93963-95-2 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2,10-Dipropionyl-10H-phenothiazine is C18H17NO2S.
The molecular weight of 2,10-Dipropionyl-10H-phenothiazine is 311.4 g/mol.
The IUPAC name of 2,10-Dipropionyl-10H-phenothiazine is 1-(10-propanoylphenothiazin-2-yl)propan-1-one.
The InChI of 2,10-Dipropionyl-10H-phenothiazine is InChI=1S/C18H17NO2S/c1-3-15(20)12-9-10-17-14(11-12)19(18(21)4-2)13-7-5-6-8-16(13)22-17/h5-11H,3-4H2,1-2H3.
The InChIKey of 2,10-Dipropionyl-10H-phenothiazine is INBFDIYBWKUJRJ-UHFFFAOYSA-N.
2,10-Dipropionyl-10H-phenothiazine has 0 hydrogen bond donor count.
2,10-Dipropionyl-10H-phenothiazine has 3 hydrogen bond acceptor count.
The topological polar surface area of 2,10-Dipropionyl-10H-phenothiazine is 62.7 Ų.
2,10-Dipropionyl-10H-phenothiazine has 22 heavy atoms.
Yes, 2,10-Dipropionyl-10H-phenothiazine is a canonicalized compound.