What is the molecular formula of 2-Oxiranecarboxylicacid,3-methyl-3-phenyl-,butyl ester?
The molecular formula is C14H18O3.
What is the molecular weight of 2-Oxiranecarboxylicacid,3-methyl-3-phenyl-,butyl ester?
The molecular weight is 234.29 g/mol.
What is the IUPAC name of 2-Oxiranecarboxylicacid,3-methyl-3-phenyl-,butyl ester?
The IUPAC name is butyl 3-methyl-3-phenyloxirane-2-carboxylate.
What is the InChI of 2-Oxiranecarboxylicacid,3-methyl-3-phenyl-,butyl ester?
The InChI is InChI=1S/C14H18O3/c1-3-4-10-16-13(15)12-14(2,17-12)11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3.
What is the InChIKey of 2-Oxiranecarboxylicacid,3-methyl-3-phenyl-,butyl ester?
The InChIKey is AWOJEIWMCLENLY-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Oxiranecarboxylicacid,3-methyl-3-phenyl-,butyl ester?
The canonical SMILES is CCCCOC(=O)C1C(O1)(C)C2=CC=CC=C2.
What is the CAS number of 2-Oxiranecarboxylicacid,3-methyl-3-phenyl-,butyl ester?
The CAS number is 93963-69-0.
What is the European Community (EC) number of 2-Oxiranecarboxylicacid,3-methyl-3-phenyl-,butyl ester?
The European Community (EC) number is 300-813-3.
What is the XLogP3-AA value of 2-Oxiranecarboxylicacid,3-methyl-3-phenyl-,butyl ester?
The XLogP3-AA value is 2.8.
Is 2-Oxiranecarboxylicacid,3-methyl-3-phenyl-,butyl ester a canonicalized compound?
Yes, it is indicated that the compound is canonicalized.