What is the molecular formula of Sodium 5,10-dihydro-5,10-dioxo-1H-anthra[2,3-d]triazolesulfonate?
The molecular formula is C14H6N3NaO5S.
What is the molecular weight of Sodium 5,10-dihydro-5,10-dioxo-1H-anthra[2,3-d]triazolesulfonate?
The molecular weight is 351.27 g/mol.
When was Sodium 5,10-dihydro-5,10-dioxo-1H-anthra[2,3-d]triazolesulfonate created?
It was created on December 10, 2008.
What is the IUPAC name of Sodium 5,10-dihydro-5,10-dioxo-1H-anthra[2,3-d]triazolesulfonate?
The IUPAC name is sodium;5,10-dioxonaphtho[2,3-f]benzotriazole-3-sulfonate.
What is the InChIKey of Sodium 5,10-dihydro-5,10-dioxo-1H-anthra[2,3-d]triazolesulfonate?
The InChIKey is AEXTUKMNBHBFAH-UHFFFAOYSA-M.
What is the Canonical SMILES representation of Sodium 5,10-dihydro-5,10-dioxo-1H-anthra[2,3-d]triazolesulfonate?
The Canonical SMILES is C1=CC=C2C(=C1)C(=O)C3=CC4=C(C=C3C2=O)N(N=N4)S(=O)(=O)[O-].[Na+].
What is the CAS number of Sodium 5,10-dihydro-5,10-dioxo-1H-anthra[2,3-d]triazolesulfonate?
The CAS number is 93918-96-8.
How many hydrogen bond acceptor counts does Sodium 5,10-dihydro-5,10-dioxo-1H-anthra[2,3-d]triazolesulfonate have?
It has 7 hydrogen bond acceptor counts.
What is the topological polar surface area of Sodium 5,10-dihydro-5,10-dioxo-1H-anthra[2,3-d]triazolesulfonate?
The topological polar surface area is 130 Ų.
Is Sodium 5,10-dihydro-5,10-dioxo-1H-anthra[2,3-d]triazolesulfonate a canonicalized compound?
Yes, it is a canonicalized compound.