What is the molecular formula of Diethyl tetrahydro-1H-1,4-diazepin-1,4(5H)-dipropionate?
The molecular formula is C15H28N2O4.
When was Diethyl tetrahydro-1H-1,4-diazepin-1,4(5H)-dipropionate created in PubChem?
It was created on August 20, 2009.
What is the IUPAC name of Diethyl tetrahydro-1H-1,4-diazepin-1,4(5H)-dipropionate?
The IUPAC name is ethyl 3-[4-(3-ethoxy-3-oxopropyl)-1,4-diazepan-1-yl]propanoate.
What is the InChIKey of Diethyl tetrahydro-1H-1,4-diazepin-1,4(5H)-dipropionate?
The InChIKey is XUQGJZGVUMUZHB-UHFFFAOYSA-N.
What is the canonical SMILES representation of Diethyl tetrahydro-1H-1,4-diazepin-1,4(5H)-dipropionate?
The canonical SMILES is CCOC(=O)CCN1CCCN(CC1)CCC(=O)OCC.
What is the CAS number of Diethyl tetrahydro-1H-1,4-diazepin-1,4(5H)-dipropionate?
The CAS number is 93894-20-3.
What is the molecular weight of Diethyl tetrahydro-1H-1,4-diazepin-1,4(5H)-dipropionate?
The molecular weight is 300.39 g/mol.
How many hydrogen bond acceptor counts does Diethyl tetrahydro-1H-1,4-diazepin-1,4(5H)-dipropionate have?
It has 6 hydrogen bond acceptor counts.
What is the topological polar surface area of Diethyl tetrahydro-1H-1,4-diazepin-1,4(5H)-dipropionate?
The topological polar surface area is 59.1 Ų.
Is Diethyl tetrahydro-1H-1,4-diazepin-1,4(5H)-dipropionate a canonicalized compound in PubChem?
Yes, it is a canonicalized compound in PubChem.