What is the PubChem CID of (1-Phenyl-1H-benzoimidazol-2-ylsulfanyl)acetic acid?
The PubChem CID is 817611.
What is the molecular formula of (1-Phenyl-1H-benzoimidazol-2-ylsulfanyl)acetic acid?
The molecular formula is C15H12N2O2S.
What is the IUPAC name of (1-Phenyl-1H-benzoimidazol-2-ylsulfanyl)acetic acid?
The IUPAC name is 2-(1-phenylbenzimidazol-2-yl)sulfanylacetic acid.
What is the InChI of (1-Phenyl-1H-benzoimidazol-2-ylsulfanyl)acetic acid?
The InChI is InChI=1S/C15H12N2O2S/c18-14(19)10-20-15-16-12-8-4-5-9-13(12)17(15)11-6-2-1-3-7-11/h1-9H,10H2,(H,18,19).
What is the InChIKey of (1-Phenyl-1H-benzoimidazol-2-ylsulfanyl)acetic acid?
The InChIKey is QJUFLXCQZGILJZ-UHFFFAOYSA-N.
What is the canonical SMILES of (1-Phenyl-1H-benzoimidazol-2-ylsulfanyl)acetic acid?
The canonical SMILES is C1=CC=C(C=C1)N2C3=CC=CC=C3N=C2SCC(=O)O.
What is the molecular weight of (1-Phenyl-1H-benzoimidazol-2-ylsulfanyl)acetic acid?
The molecular weight is 284.3 g/mol.
What is the XLogP3-AA value of (1-Phenyl-1H-benzoimidazol-2-ylsulfanyl)acetic acid?
The XLogP3-AA value is 3.5.
How many hydrogen bond donor counts are there in (1-Phenyl-1H-benzoimidazol-2-ylsulfanyl)acetic acid?
There is 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts are there in (1-Phenyl-1H-benzoimidazol-2-ylsulfanyl)acetic acid?
There are 4 hydrogen bond acceptor counts.