What is the molecular formula of 1-Isopropyl-5-methyl-1H-1,2,4-triazol-3-amine?
The molecular formula is C6H12N4.
When was the structure of 1-Isopropyl-5-methyl-1H-1,2,4-triazol-3-amine created and modified?
The structure was created on 2009-05-28 and modified on 2023-12-30.
What is the IUPAC name of 1-Isopropyl-5-methyl-1H-1,2,4-triazol-3-amine?
The IUPAC name is 5-methyl-1-propan-2-yl-1,2,4-triazol-3-amine.
What is the InChI of 1-Isopropyl-5-methyl-1H-1,2,4-triazol-3-amine?
The InChI is InChI=1S/C6H12N4/c1-4(2)10-5(3)8-6(7)9-10/h4H,1-3H3,(H2,7,9).
How many hydrogen bond donor counts does 1-Isopropyl-5-methyl-1H-1,2,4-triazol-3-amine have?
It has 1 hydrogen bond donor count.
What is the exact mass of 1-Isopropyl-5-methyl-1H-1,2,4-triazol-3-amine?
The exact mass is 140.106196400 g/mol.
What is the topological polar surface area of 1-Isopropyl-5-methyl-1H-1,2,4-triazol-3-amine?
The topological polar surface area is 56.7 Ų.
How many heavy atoms are present in 1-Isopropyl-5-methyl-1H-1,2,4-triazol-3-amine?
There are 10 heavy atoms.
Does 1-Isopropyl-5-methyl-1H-1,2,4-triazol-3-amine have any defined atom stereocenter count?
No, it does not have any defined atom stereocenter count.
Is the compound canonicalized?
Yes, the compound is canonicalized according to PubChem.