What is the molecular formula of N-(2-Aminoethyl)-N-octylethylenediamine?
The molecular formula is C12H29N3.
What is the molecular weight of N-(2-Aminoethyl)-N-octylethylenediamine?
The molecular weight is 215.38 g/mol.
What is the IUPAC name of N-(2-Aminoethyl)-N-octylethylenediamine?
The IUPAC name is N'-(2-aminoethyl)-N'-octylethane-1,2-diamine.
What is the InChI of N-(2-Aminoethyl)-N-octylethylenediamine?
The InChI is InChI=1S/C12H29N3/c1-2-3-4-5-6-7-10-15(11-8-13)12-9-14/h2-14H2,1H3.
What is the InChIKey of N-(2-Aminoethyl)-N-octylethylenediamine?
The InChIKey is NAPBLZKQMLMWHK-UHFFFAOYSA-N.
What is the molecular weight of N-(2-Aminoethyl)-N-octylethylenediamine according to PubChem?
The molecular weight is 215.38 g/mol, computed by PubChem.
How many hydrogen bond donor counts does N-(2-Aminoethyl)-N-octylethylenediamine have?
It has 2 hydrogen bond donor counts.
How many rotatable bond counts does N-(2-Aminoethyl)-N-octylethylenediamine have?
It has 11 rotatable bond counts.
Is the compound canonicalized according to PubChem?
Yes, the compound is canonicalized according to PubChem.
What is the topological polar surface area of N-(2-Aminoethyl)-N-octylethylenediamine?
The topological polar surface area is 55.3 Ų.