93819-94-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 5-(3-Sulfopropoxy)isophthalic acid is C11H12O8S.
The molecular weight of 5-(3-Sulfopropoxy)isophthalic acid is 304.27 g/mol.
The IUPAC Name of 5-(3-Sulfopropoxy)isophthalic acid is 5-(3-sulfopropoxy)benzene-1,3-dicarboxylic acid.
The InChIKey of 5-(3-Sulfopropoxy)isophthalic acid is UTCFIWKVMIMCFB-UHFFFAOYSA-N.
The Canonical SMILES of 5-(3-Sulfopropoxy)isophthalic acid is C1=C(C=C(C=C1C(=O)O)OCCCS(=O)(=O)O)C(=O)O.
The CAS number of 5-(3-Sulfopropoxy)isophthalic acid is 93820-01-0.
There are 3 hydrogen bond donor counts in 5-(3-Sulfopropoxy)isophthalic acid.
The XLogP3-AA value of 5-(3-Sulfopropoxy)isophthalic acid is 0.2.
There are 7 rotatable bond counts in 5-(3-Sulfopropoxy)isophthalic acid.
Yes, the compound is canonicalized in PubChem.