What is the molecular formula of Dihydrofuran-2,3-dione 3-[(2-hydroxyphenyl)hydrazone]?
The molecular formula is C10H10N2O3.
What is the molecular weight of Dihydrofuran-2,3-dione 3-[(2-hydroxyphenyl)hydrazone]?
The molecular weight is 206.20 g/mol.
When was Dihydrofuran-2,3-dione 3-[(2-hydroxyphenyl)hydrazone] created and modified in PubChem?
It was created on 2007-12-06 and modified on 2023-12-30.
What is the IUPAC name of Dihydrofuran-2,3-dione 3-[(2-hydroxyphenyl)hydrazone]?
The IUPAC name is (3E)-3-[(2-hydroxyphenyl)hydrazinylidene]oxolan-2-one.
What is the InChI of Dihydrofuran-2,3-dione 3-[(2-hydroxyphenyl)hydrazone]?
The InChI is InChI=1S/C10H10N2O3/c13-9-4-2-1-3-7(9)11-12-8-5-6-15-10(8)14/h1-4,11,13H,5-6H2/b12-8+.
How many hydrogen bond donor counts does Dihydrofuran-2,3-dione 3-[(2-hydroxyphenyl)hydrazone] have?
It has 2 hydrogen bond donor counts.
What is the formal charge of Dihydrofuran-2,3-diene 3-[(2-hydroxyphenyl)hydrazone]?
The formal charge is 0.
How many rotatable bond counts does Dihydrofuran-2,3-dione 3-[(2-hydroxyphenyl)hydrazone] have?
It has 2 rotatable bond counts.
Is Dihydrofuran-2,3-dione 3-[(2-hydroxyphenyl)hydrazone] a canonicalized compound?
Yes, it is a canonicalized compound.
What is the topological polar surface area of Dihydrofuran-2,3-dione 3-[(2-hydroxyphenyl)hydrazone]?
The topological polar surface area is 70.9 Å2.