What is the molecular formula of Benzeneacetic acid,4-hydroxy-a-methyl according to the reference?
The molecular formula is C9H10O3.
What is the molecular weight of Benzeneacetic acid,4-hydroxy-a-methyl?
The molecular weight is 166.17 g/mol.
What is the IUPAC name of Benzeneacetic acid,4-hydroxy-a-methyl?
The IUPAC name is 2-(4-hydroxyphenyl)propanoic acid.
What is the Canonical SMILES of Benzeneacetic acid,4-hydroxy-a-methyl?
The Canonical SMILES is CC(C1=CC=C(C=C1)O)C(=O)O.
What is the InChI Key of Benzeneacetic acid,4-hydroxy-a-methyl?
The InChI Key is ZHMMPVANGNPCBW-UHFFFAOYSA-N.
Which other identifiers are associated with Benzeneacetic acid,4-hydroxy-a-methyl?
Other identifiers include CAS number 938-96-5, EC number 213-352-7, UNII 55FH3476SI, and more.
What is the exact mass of Benzeneacetic acid,4-hydroxy-a-methyl?
The exact mass is 166.062994177 g/mol.
How many hydrogen bond donor and acceptor counts does Benzeneacetic acid,4-hydroxy-a-methyl have?
It has 2 hydrogen bond donor counts and 3 hydrogen bond acceptor counts.
What is the topological polar surface area of Benzeneacetic acid,4-hydroxy-a-methyl?
The topological polar surface area is 57.5 Å2.
How many rotatable bond counts does Benzeneacetic acid,4-hydroxy-a-methyl have?
It has 2 rotatable bond counts.