93870-41-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of ethyl 3,4-dimethyl-1H-pyrrole-2-carboxylate is C9H13NO2.
The IUPAC name of the compound is ethyl 3,4-dimethyl-1H-pyrrole-2-carboxylate.
The InChI of the compound is InChI=1S/C9H13NO2/c1-4-12-9(11)8-7(3)6(2)5-10-8/h5,10H,4H2,1-3H3.
The InChIKey of the compound is XUIPYRXOVPTMHC-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCOC(=O)C1=C(C(=CN1)C)C.
The molecular weight of the compound is 167.20 g/mol.
The XLogP3-AA value of the compound is 2.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor count.
The compound has 3 rotatable bond count.