What is the molecular formula of N-Methyl-[(4-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)methyl]amine?
The molecular formula is C11H16N2O.
What is the molecular weight of N-Methyl-[(4-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)methyl]amine?
The molecular weight is 192.26 g/mol.
What is the IUPAC name of N-Methyl-[(4-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)methyl]amine?
The IUPAC name is N-methyl-1-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)methanamine.
What is the Canonical SMILES representation of N-Methyl-[(4-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)methyl]amine?
It is CNCC1=CC2=C(C=C1)N(CCO2)C.
How many hydrogen bond donors are present in N-Methyl-[(4-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)methyl]amine?
There is 1 hydrogen bond donor.
How many hydrogen bond acceptors are present in N-Methyl-[(4-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)methyl]amine?
There are 3 hydrogen bond acceptors.
What is the XLogP3-AA value of N-Methyl-[(4-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)methyl]amine?
The XLogP3-AA value is 1.2.
What is the topological polar surface area of N-Methyl-[(4-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)methyl]amine?
The topological polar surface area is 24.5 Ų.
How many rotatable bond counts are there in N-Methyl-[(4-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)methyl]amine?
There are 2 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.