What is the molecular formula of 6-Bromo-2-methoxy-1,2,3,4-tetrahydronaphthalene?
The molecular formula is C11H13BrO.
What is the molecular weight of 6-Bromo-2-methoxy-1,2,3,4-tetrahydronaphthalene?
The molecular weight is 241.12 g/mol.
When was 6-Bromo-2-methoxy-1,2,3,4-tetrahydronaphthalene created?
It was created on October 30, 2011.
When was 6-Bromo-2-methoxy-1,2,3,4-tetrahydronaphthalene last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of 6-Bromo-2-methoxy-1,2,3,4-tetrahydronaphthalene?
The IUPAC name is 6-bromo-2-methoxy-1,2,3,4-tetrahydronaphthalene.
What is the InChI of 6-Bromo-2-methoxy-1,2,3,4-tetrahydronaphthalene?
The InChI is InChI=1S/C11H13BrO/c1-13-11-5-3-8-6-10(12)4-2-9(8)7-11/h2,4,6,11H,3,5,7H2,1H3.
What is the InChIKey of 6-Bromo-2-methoxy-1,2,3,4-tetrahydronaphthalene?
The InChIKey is DPWCEMKSEMIPCF-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromo-2-methoxy-1,2,3,4-tetrahydronaphthalene?
The canonical SMILES is COC1CCC2=C(C1)C=CC(=C2)Br.
What is the CAS number of 6-Bromo-2-methoxy-1,2,3,4-tetrahydronaphthalene?
The CAS number is 937594-14-4.
What is the XLogP3-AA value of 6-Bromo-2-methoxy-1,2,3,4-tetrahydronaphthalene?
The XLogP3-AA value is 3.2.