936250-23-6 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H6BF5O3.
The IUPAC name of the compound is [3,5-difluoro-2-(2,2,2-trifluoroethoxy)phenyl]boronic acid.
The InChI of the compound is InChI=1S/C8H6BF5O3/c10-4-1-5(9(15)16)7(6(11)2-4)17-3-8(12,13)14/h1-2,15-16H,3H2.
The InChIKey of the compound is AZYREAMQJBZUHH-UHFFFAOYSA-N.
The canonical SMILES of the compound is B(C1=CC(=CC(=C1OCC(F)(F)F)F)F)(O)O.
The molecular weight of the compound is 255.94 g/mol.
The compound has 2 hydrogen bond donor counts.
The compound has 8 hydrogen bond acceptor counts.
The compound has 3 rotatable bond counts.
Yes, the compound is canonicalized.