What is the molecular formula of 4-Amino-2-diethylamino-pyrimidine-5-carbonitrile?
The molecular formula is C9H13N5.
What are some synonyms for 4-Amino-2-diethylamino-pyrimidine-5-carbonitrile?
Some synonyms include 93606-29-2, 4-amino-2-(diethylamino)pyrimidine-5-carbonitrile, and Maybridge2_000541.
When was 4-Amino-2-diethylamino-pyrimidine-5-carbonitrile created in PubChem?
It was created on July 19, 2005.
What is the InChI of 4-Amino-2-diethylamino-pyrimidine-5-carbonitrile?
The InChI is InChI=1S/C9H13N5/c1-3-14(4-2)9-12-6-7(5-10)8(11)13-9/h6H,3-4H2,1-2H3,(H2,11,12,13).
What is the molecular weight of 4-Amino-2-diethylamino-pyrimidine-5-carbonitrile?
The molecular weight is 191.23 g/mol.
How many hydrogen bond acceptor counts does 4-Amino-2-diethylamino-pyrimidine-5-carbonitrile have?
It has 5 hydrogen bond acceptor counts.
What is the topological polar surface area of 4-Amino-2-diethylamino-pyrimidine-5-carbonitrile?
The topological polar surface area is 78.8 Ų.
How many heavy atoms are present in 4-Amino-2-diethylamino-pyrimidine-5-carbonitrile?
There are 14 heavy atoms present.
Is 4-Amino-2-diethylamino-pyrimidine-5-carbonitrile a canonicalized compound?
Yes, the compound is canonicalized.
What is the formal charge of 4-Amino-2-diethylamino-pyrimidine-5-carbonitrile?
The formal charge is 0.