CAS
93523-67-2 Purity
99 atom % D
93523-67-2 Purity
99 atom % D
Inquiry Basket
3,3-Difluoro-piperidin-1-ylamine
CAS
935260-59-6
Catalog Number
ACM935260596
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3,3-Difluoro-piperidin-1-ylamine?
The molecular formula of 3,3-Difluoro-piperidin-1-ylamine is C5H10F2N2.
What is the molecular weight of 3,3-Difluoro-piperidin-1-ylamine?
The molecular weight of 3,3-Difluoro-piperidin-1-ylamine is 136.14 g/mol.
What is the IUPAC name of 3,3-Difluoro-piperidin-1-ylamine?
The IUPAC name of 3,3-Difluoro-piperidin-1-ylamine is 3,3-difluoropiperidin-1-amine.
What is the InChI of 3,3-Difluoro-piperidin-1-ylamine?
The InChI of 3,3-Difluoro-piperidin-1-ylamine is InChI=1S/C5H10F2N2/c6-5(7)2-1-3-9(8)4-5/h1-4,8H2.
What is the InChIKey of 3,3-Difluoro-piperidin-1-ylamine?
The InChIKey of 3,3-Difluoro-piperidin-1-ylamine is QIFZYYCRZCRTFA-UHFFFAOYSA-N.
What is the canonical SMILES of 3,3-Difluoro-piperidin-1-ylamine?
The canonical SMILES of 3,3-Difluoro-piperidin-1-ylamine is C1CC(CN(C1)N)(F)F.
What is the XLogP3-AA value of 3,3-Difluoro-piperidin-1-ylamine?
The XLogP3-AA value of 3,3-Difluoro-piperidin-1-ylamine is 0.7.
How many hydrogen bond donor counts does 3,3-Difluoro-piperidin-1-ylamine have?
3,3-Difluoro-piperidin-1-ylamine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3,3-Difluoro-piperidin-1-ylamine have?
3,3-Difluoro-piperidin-1-ylamine has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does 3,3-Difluoro-piperidin-1-ylamine have?
3,3-Difluoro-piperidin-1-ylamine has 0 rotatable bond counts.
Recommended Products
![5-[2-(Dipropylamino)ethyl]-1,4-dihydro-3H-2,1-benzoxazin-3-one hydrochloride](https://resource.alfa-chemistry.com/structure/935266-34-5.gif)
CAS
935266-34-5 Purity
96%
935266-34-5 Purity
96%
