935-04-6 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 1-(2-chloroethyl)-1-(4-cyanophenyl)urea.
The InChI of the compound is InChI=1S/C10H10ClN3O/c11-5-6-14(10(13)15)9-3-1-8(7-12)2-4-9/h1-4H,5-6H2,(H2,13,15).
The InChIKey of the compound is SLZODBAIHUIOPO-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC=C1C#N)N(CCCl)C(=O)N.
The molecular weight of the compound is 223.66 g/mol.
The XLogP3-AA value of the compound is 1.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The compound has 3 rotatable bond counts.
The topological polar surface area of the compound is 70.1 ?2.