CAS
93469-29-5 Purity
---
93469-29-5 Purity
---
Inquiry Basket
ACETAMIDE,N-(6-AMINO-3-CYANO-4-METHYL-PYRIDIN-2-YL)-
CAS
934708-59-5
Catalog Number
ACM934708595
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C9H10N4O.
What is the molecular weight of the compound?
The molecular weight of the compound is 190.20 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-(6-amino-3-cyano-4-methylpyridin-2-yl)acetamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H10N4O/c1-5-3-8(11)13-9(7(5)4-10)12-6(2)14/h3H,1-2H3,(H3,11,12,13,14).
What is the InChIKey of the compound?
The InChIKey of the compound is ZKXNHPUREJEUMG-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=CC(=NC(=C1C#N)NC(=O)C)N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.6.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 1 rotatable bond count.
Recommended Products
