What is the molecular formula of Pentafluorophenyl 2-thiomorpholin-4-ylpyridine-4-carboxylate?
The molecular formula is C16H11F5N2O2S.
When was Pentafluorophenyl 2-thiomorpholin-4-ylpyridine-4-carboxylate created?
It was created on 2008-02-29.
What is the InChI of Pentafluorophenyl 2-thiomorpholin-4-ylpyridine-4-carboxylate?
The InChI is InChI=1S/C16H11F5N2O2S/c17-10-11(18)13(20)15(14(21)12(10)19)25-16(24)8-1-2-22-9(7-8)23-3-5-26-6-4-23/h1-2,7H,3-6H2.
What is the CAS number of Pentafluorophenyl 2-thiomorpholin-4-ylpyridine-4-carboxylate?
The CAS number is 934570-42-0.
What is the XLogP3-AA value of Pentafluorophenyl 2-thiomorpholin-4-ylpyridine-4-carboxylate?
The XLogP3-AA value is 3.6.
How many hydrogen bond acceptors does Pentafluorophenyl 2-thiomorpholin-4-ylpyridine-4-carboxylate have?
It has 10 hydrogen bond acceptors.
What is the exact mass of Pentafluorophenyl 2-thiomorpholin-4-ylpyridine-4-carboxylate?
The exact mass is 390.04613958 g/mol.
How many rotatable bond counts does Pentafluorophenyl 2-thiomorpholin-4-ylpyridine-4-carboxylate have?
It has 4 rotatable bond counts.
What is the complexity value of Pentafluorophenyl 2-thiomorpholin-4-ylpyridine-4-carboxylate?
The complexity value is 483.
Is Pentafluorophenyl 2-thiomorpholin-4-ylpyridine-4-carboxylate considered as a canonicalized compound?
Yes, it is considered as a canonicalized compound.