933698-87-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H14FNO.
The molecular weight of the compound is 195.23 g/mol.
The IUPAC name of the compound is 3-(4-fluorophenoxy)piperidine.
The InChI of the compound is InChI=1S/C11H14FNO/c12-9-3-5-10(6-4-9)14-11-2-1-7-13-8-11/h3-6,11,13H,1-2,7-8H2.
The InChIKey of the compound is SFOSPFWMUDDDII-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CC(CNC1)OC2=CC=C(C=C2)F.
The XLogP3-AA value of the compound is 2.1.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.
The compound has 2 rotatable bond counts.