What is the molecular formula of (R)-Methyl 1-(4-chlorophenyl)aziridine-2-carboxylate?
The molecular formula is C10H10ClNO2.
What is the molecular weight of (R)-Methyl 1-(4-chlorophenyl)aziridine-2-carboxylate?
The molecular weight is 211.64 g/mol.
What is the IUPAC name of (R)-Methyl 1-(4-chlorophenyl)aziridine-2-carboxylate?
The IUPAC name is methyl (2R)-1-(4-chlorophenyl)aziridine-2-carboxylate.
What is the InChI of (R)-Methyl 1-(4-chlorophenyl)aziridine-2-carboxylate?
The InChI is InChI=1S/C10H10ClNO2/c1-14-10(13)9-6-12(9)8-4-2-7(11)3-5-8/h2-5,9H,6H2,1H3/t9-,12?/m1/s1.
What is the InChIKey of (R)-Methyl 1-(4-chlorophenyl)aziridine-2-carboxylate?
The InChIKey is LISSBMTZNHZBLL-PKEIRNPWSA-N.
What is the canonical SMILES of (R)-Methyl 1-(4-chlorophenyl)aziridine-2-carboxylate?
The canonical SMILES is COC(=O)C1CN1C2=CC=C(C=C2)Cl.
What is the isomeric SMILES of (R)-Methyl 1-(4-chlorophenyl)aziridine-2-carboxylate?
The isomeric SMILES is COC(=O)[C@H]1CN1C2=CC=C(C=C2)Cl.
What is the XLogP3-AA value of (R)-Methyl 1-(4-chlorophenyl)aziridine-2-carboxylate?
The XLogP3-AA value is 2.4.
How many hydrogen bond acceptor counts does (R)-Methyl 1-(4-chlorophenyl)aziridine-2-carboxylate have?
It has 3 hydrogen bond acceptor counts.
Is (R)-Methyl 1-(4-chlorophenyl)aziridine-2-carboxylate a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.