What is the molecular formula of Cyclopentanecarboxylic acid, 2-hydroxy-, methyl ester, (1R,2S)-rel- according to the reference?
The molecular formula is C7H12O3.
What is the molecular weight of Cyclopentanecarboxylic acid, 2-hydroxy-, methyl ester, (1R,2S)-rel-?
The molecular weight is 144.17 g/mol.
What is the IUPAC name of Cyclopentanecarboxylic acid, 2-hydroxy-, methyl ester, (1R,2S)-rel-?
The IUPAC name is methyl 2-hydroxycyclopentane-1-carboxylate.
What is the InChI of Cyclopentanecarboxylic acid, 2-hydroxy-, methyl ester, (1R,2S)-rel-?
The InChI is InChI=1S/C7H12O3/c1-10-7(9)5-3-2-4-6(5)8/h5-6,8H,2-4H2,1H3.
What is the InChIKey of Cyclopentanecarboxylic acid, 2-hydroxy-, methyl ester, (1R,2S)-rel-?
The InChIKey is XMPIOOIEGQJDKJ-UHFFFAOYSA-N.
What is the Canonical SMILES of Cyclopentanecarboxylic acid, 2-hydroxy-, methyl ester, (1R,2S)-rel-?
The Canonical SMILES is COC(=O)C1CCCC1O.
What is the XLogP3-AA value of Cyclopentanecarboxylic acid, 2-hydroxy-, methyl ester, (1R,2S)-rel-?
The XLogP3-AA value is 0.9.
How many hydrogen bond donor counts are present in Cyclopentanecarboxylic acid, 2-hydroxy-, methyl ester, (1R,2S)-rel-?
There is 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts are present in Cyclopentanecarboxylic acid, 2-hydroxy-, methyl ester, (1R,2S)-rel-?
There are 3 hydrogen bond acceptor counts.
Is Cyclopentanecarboxylic acid, 2-hydroxy-, methyl ester, (1R,2S)-rel- considered as a canonicalized compound?
Yes, it is considered as a canonicalized compound.