What is the molecular formula of 6-Bromo-1,2-benzisothiazole-3-carboxylic acid 1,1-dimethylethyl ester?
The molecular formula is C12H12BrNO2S.
What are the synonyms of 6-Bromo-1,2-benzisothiazole-3-carboxylic acid 1,1-dimethylethyl ester?
The synonyms are 932702-07-3, tert-butyl 6-bromobenzo[d]isothiazole-3-carboxylate, and tert-butyl 6-bromo-1,2-benzothiazole-3-carboxylate.
What is the molecular weight of 6-Bromo-1,2-benzisothiazole-3-carboxylic acid 1,1-dimethylethyl ester?
The molecular weight is 314.20 g/mol.
When was it created?
It was created on July 12, 2012.
When was it last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of 6-Bromo-1,2-benzisothiazole-3-carboxylic acid 1,1-dimethylethyl ester?
The IUPAC name is tert-butyl 6-bromo-1,2-benzothiazole-3-carboxylate.
What is the InChI of 6-Bromo-1,2-benzisothiazole-3-carboxylic acid 1,1-dimethylethyl ester?
The InChI is InChI=1S/C12H12BrNO2S/c1-12(2,3)16-11(15)10-8-5-4-7(13)6-9(8)17-14-10/h4-6H,1-3H3.
What is the InChIKey of 6-Bromo-1,2-benzisothiazole-3-carboxylic acid 1,1-dimethylethyl ester?
The InChIKey is ULLIEAKUNMXLAM-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromo-1,2-benzisothiazole-3-carboxylic acid 1,1-dimethylethyl ester?
The canonical SMILES is CC(C)(C)OC(=O)C1=NSC2=C1C=CC(=C2)Br.
What is the CAS number of 6-Bromo-1,2-benzisothiazole-3-carboxylic acid 1,1-dimethylethyl ester?
The CAS number is 932702-07-3.