What is the molecular formula of 2-Thiazolamine,4-(2,4-dichlorophenyl)?
The molecular formula is C9H6Cl2N2S.
What is the molecular weight of 2-Thiazolamine,4-(2,4-dichlorophenyl)?
The molecular weight is 245.13 g/mol.
What is the IUPAC name of 2-Thiazolamine,4-(2,4-dichlorophenyl)?
The IUPAC name is 4-(2,4-dichlorophenyl)-1,3-thiazol-2-amine.
What is the InChI of 2-Thiazolamine,4-(2,4-dichlorophenyl)?
The InChI is InChI=1S/C9H6Cl2N2S/c10-5-1-2-6(7(11)3-5)8-4-14-9(12)13-8/h1-4H,(H2,12,13).
What is the InChIKey of 2-Thiazolamine,4-(2,4-dichlorophenyl)?
The InChIKey is APJACVDBTHESJL-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Thiazolamine,4-(2,4-dichlorophenyl)?
The canonical SMILES is C1=CC(=C(C=C1Cl)Cl)C2=CSC(=N2)N.
What is the CAS number of 2-Thiazolamine,4-(2,4-dichlorophenyl)?
The CAS number is 93209-97-3.
What is the XLogP3-AA value of 2-Thiazolamine,4-(2,4-dichlorophenyl)?
The XLogP3-AA value is 3.5.
How many hydrogen bond donor counts does 2-Thiazolamine,4-(2,4-dichlorophenyl) have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Thiazolamine,4-(2,4-dichlorophenyl) have?
It has 3 hydrogen bond acceptor counts.