What is the molecular formula of 1H-Pyrrolo[2,3-b]pyridine, 4-(1-piperidinyl)?
The molecular formula is C12H15N3.
When was 1H-Pyrrolo[2,3-b]pyridine, 4-(1-piperidinyl) first created according to PubChem?
It was first created on December 5, 2007.
What is the molecular weight of 1H-Pyrrolo[2,3-b]pyridine, 4-(1-piperidinyl)?
The molecular weight is 201.27 g/mol.
What is the IUPAC name of 1H-Pyrrolo[2,3-b]pyridine, 4-(1-piperidinyl)?
The IUPAC name is 4-piperidin-1-yl-1H-pyrrolo[2,3-b]pyridine.
What is the InChI of 1H-Pyrrolo[2,3-b]pyridine, 4-(1-piperidinyl)?
The InChI is InChI=1S/C12H15N3/c1-2-8-15(9-3-1)11-5-7-14-12-10(11)4-6-13-12/h4-7H,1-3,8-9H2,(H,13,14).
What is the Canonical SMILES of 1H-Pyrrolo[2,3-b]pyridine, 4-(1-piperidinyl)?
The Canonical SMILES is C1CCN(CC1)C2=C3C=CNC3=NC=C2.
How many hydrogen bond donor counts does 1H-Pyrrolo[2,3-b]pyridine, 4-(1-piperidinyl) have?
It has 1 hydrogen bond donor count.
What is the exact mass of 1H-Pyrrolo[2,3-b]pyridine, 4-(1-piperidinyl)?
The exact mass is 201.126597491 g/mol.
How many heavy atoms are present in 1H-Pyrrolo[2,3-b]pyridine, 4-(1-piperidinyl)?
There are 15 heavy atoms.
Is the compound considered canonicalized?
Yes, the compound is canonicalized according to PubChem.