931088-06-1 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2,5-Dichloro-N-methylnicotinamide is C7H6Cl2N2O.
The molecular weight of 2,5-Dichloro-N-methylnicotinamide is 205.04 g/mol.
The IUPAC name of 2,5-Dichloro-N-methylnicotinamide is 2,5-dichloro-N-methylpyridine-3-carboxamide.
The InChI of 2,5-Dichloro-N-methylnicotinamide is InChI=1S/C7H6Cl2N2O/c1-10-7(12)5-2-4(8)3-11-6(5)9/h2-3H,1H3,(H,10,12).
The InChIKey of 2,5-Dichloro-N-methylnicotinamide is VPMWKZHRYGXBCK-UHFFFAOYSA-N.
The Canonical SMILES of 2,5-Dichloro-N-methylnicotinamide is CNC(=O)C1=C(N=CC(=C1)Cl)Cl.
The XLogP3-AA value of 2,5-Dichloro-N-methylnicotinamide is 1.7.
There is 1 hydrogen bond donor atom in 2,5-Dichloro-N-methylnicotinamide.
There are 2 hydrogen bond acceptor atoms in 2,5-Dichloro-N-methylnicotinamide.
There is 1 rotatable bond in 2,5-Dichloro-N-methylnicotinamide.