What is the molecular formula of tert-Butyl 1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate?
The molecular formula is C13H24N2O3.
What is the molecular weight of tert-Butyl 1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate?
The molecular weight is 256.34 g/mol.
When was tert-Butyl 1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate created?
It was created on August 5, 2011.
What is the IUPAC name of tert-Butyl 1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate?
The IUPAC name is tert-butyl 1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate.
What is the InChI of tert-Butyl 1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate?
The InChI is InChI=1S/C13H24N2O3/c1-12(2,3)18-11(16)15-7-4-13(5-8-15)10-14-6-9-17-13/h14H,4-10H2,1-3H3.
What is the InChIKey of tert-Butyl 1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate?
The InChIKey is FRROFBJYHIEDPS-UHFFFAOYSA-N.
What is the canonical SMILES of tert-Butyl 1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate?
The canonical SMILES is CC(C)(C)OC(=O)N1CCC2(CC1)CNCCO2.
What is the CAS number of tert-Butyl 1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate?
The CAS number is 930785-40-3.
Is tert-Butyl 1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate considered as a canonicalized compound?
Yes, it is considered as a canonicalized compound.