930-58-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H12FNO.
The synonyms for the compound are N-(3-Fluoro-4,5-dimethylphenyl)-acetamide, 930599-55-6, N-(3-fluoro-4,5-dimethylphenyl)acetamide, SCHEMBL5305674, and DTXSID501275057.
The molecular weight of the compound is 181.21 g/mol.
The IUPAC name of the compound is N-(3-fluoro-4,5-dimethylphenyl)acetamide.
The InChI of the compound is InChI=1S/C10H12FNO/c1-6-4-9(12-8(3)13)5-10(11)7(6)2/h4-5H,1-3H3,(H,12,13).
The InChIKey of the compound is MGLQOISALXIQCC-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=CC(=CC(=C1C)F)NC(=O)C.
The CAS number of the compound is 930599-55-6.
The XLogP3-AA value of the compound is 1.9.
Yes, the compound is canonicalized.