What is the molecular formula of Pentafluorophenyl 4-(tetrahydropyran-4-yloxy)benzoate?
The molecular formula is C18H13F5O4.
When was Pentafluorophenyl 4-(tetrahydropyran-4-yloxy)benzoate created in PubChem?
It was created on 2008-02-29.
What is the molecular weight of Pentafluorophenyl 4-(tetrahydropyran-4-yloxy)benzoate?
The molecular weight is 388.3 g/mol.
How many Hydrogen Bond Acceptor Count does Pentafluorophenyl 4-(tetrahydropyran-4-yloxy)benzoate have?
It has 9 Hydrogen Bond Acceptor Count.
What is the Canonical SMILES of Pentafluorophenyl 4-(tetrahydropyran-4-yloxy)benzoate?
The Canonical SMILES is C1COCCC1OC2=CC=C(C=C2)C(=O)OC3=C(C(=C(C(=C3F)F)F)F)F.
What is the InChIKey of Pentafluorophenyl 4-(tetrahydropyran-4-yloxy)benzoate?
The InChIKey is BDWCEFHYQPZQRO-UHFFFAOYSA-N.
How many Rotatable Bond Count does Pentafluorophenyl 4-(tetrahydropyran-4-yloxy)benzoate have?
It has 5 Rotatable Bond Count.
What is the Exact Mass of Pentafluorophenyl 4-(tetrahydropyran-4-yloxy)benzoate?
The Exact Mass is 388.07339970 g/mol.
Is Pentafluorophenyl 4-(tetrahydropyran-4-yloxy)benzoate a Covalently-Bonded Unit?
Yes, it is a Covalently-Bonded Unit.
How many Heavy Atom Count does Pentafluorophenyl 4-(tetrahydropyran-4-yloxy)benzoate have?
It has 27 Heavy Atom Count.