CAS
92988-11-9 Purity
---
92988-11-9 Purity
---
Inquiry Basket
3-Chloroisonicotinaldehyde
CAS
92990-37-5
Catalog Number
ACM92990375
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Chloroisonicotinaldehyde?
The molecular formula of 3-Chloroisonicotinaldehyde is C6H4ClNO.
What is the molecular weight of 3-Chloroisonicotinaldehyde?
The molecular weight of 3-Chloroisonicotinaldehyde is 141.55 g/mol.
What is the IUPAC name of 3-Chloroisonicotinaldehyde?
The IUPAC name of 3-Chloroisonicotinaldehyde is 3-chloropyridine-4-carbaldehyde.
What is the InChI of 3-Chloroisonicotinaldehyde?
The InChI of 3-Chloroisonicotinaldehyde is InChI=1S/C6H4ClNO/c7-6-3-8-2-1-5(6)4-9/h1-4H.
What is the InChIKey of 3-Chloroisonicotinaldehyde?
The InChIKey of 3-Chloroisonicotinaldehyde is ZVGDKOQPJCOCLI-UHFFFAOYSA-N.
How many hydrogen bond donor counts are there in 3-Chloroisonicotinaldehyde?
There are 0 hydrogen bond donor counts in 3-Chloroisonicotinaldehyde.
What is the XLogP3-AA value of 3-Chloroisonicotinaldehyde?
The XLogP3-AA value of 3-Chloroisonicotinaldehyde is 0.9.
How many heavy atoms are there in 3-Chloroisonicotinaldehyde?
There are 9 heavy atoms in 3-Chloroisonicotinaldehyde.
Is 3-Chloroisonicotinaldehyde a canonicalized compound?
Yes, 3-Chloroisonicotinaldehyde is a canonicalized compound.
What is the topological polar surface area of 3-Chloroisonicotinaldehyde?
The topological polar surface area of 3-Chloroisonicotinaldehyde is 30 Ų.
Recommended Products
![Sodium strontium 2-[bis(2-oxido-2-oxoethyl)amino]acetate](https://resource.alfa-chemistry.com/structure/92988-11-9.gif)
CAS
929884-77-5 Purity
96%
929884-77-5 Purity
96%
![8'-Methoxy-1,3,3,5-tetramethyl-6'-nitrospiro[indoline-2,2'-thiochromene]](https://resource.alfa-chemistry.com/structure/92990-73-3.gif)
CAS
92990-73-3 Purity
---
92990-73-3 Purity
---
