What is the molecular formula of 7-Chloro-2-methyl-1H-imidazo[4,5-c]pyridine?
The molecular formula is C7H6ClN3.
When was 7-Chloro-2-methyl-1H-imidazo[4,5-c]pyridine created and modified?
It was created on 2007-11-16 and last modified on 2023-12-30.
What is the IUPAC name of 7-Chloro-2-methyl-1H-imidazo[4,5-c]pyridine?
The IUPAC name is 7-chloro-2-methyl-3H-imidazo[4,5-c]pyridine.
What is the InChI of 7-Chloro-2-methyl-1H-imidazo[4,5-c]pyridine?
The InChI is InChI=1S/C7H6ClN3/c1-4-10-6-3-9-2-5(8)7(6)11-4/h2-3H,1H3,(H,10,11).
What is the molecular weight of 7-Chloro-2-methyl-1H-imidazo[4,5-c]pyridine?
The molecular weight is 167.59 g/mol.
What is the CAS number of 7-Chloro-2-methyl-1H-imidazo[4,5-c]pyridine?
The CAS number is 929074-44-2.
How many hydrogen bond donor counts does 7-Chloro-2-methyl-1H-imidazo[4,5-c]pyridine have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 7-Chloro-2-methyl-1H-imidazo[4,5-c]pyridine?
The topological polar surface area is 41.6 Å2.
Is 7-Chloro-2-methyl-1H-imidazo[4,5-c]pyridine a canonicalized compound?
Yes, it is a canonicalized compound.
How many rotatable bond counts does 7-Chloro-2-methyl-1H-imidazo[4,5-c]pyridine have?
It has 0 rotatable bond counts.