92902-99-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 4-methoxy-1H-indol-5-ol.
The molecular formula of the compound is C9H9NO2.
The molecular weight of the compound is 163.17 g/mol.
The InChI of the compound is InChI=1S/C9H9NO2/c1-12-9-6-4-5-10-7(6)2-3-8(9)11/h2-5,10-11H,1H3.
The InChIKey of the compound is WUCBSYXOZGZJNF-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC1=C(C=CC2=C1C=CN2)O.
The XLogP3-AA value of the compound is 1.7.
The compound has 2 hydrogen bond donor counts.
The compound has 2 hydrogen bond acceptor counts.
The compound has 1 rotatable bond count.