If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C6H5NO2S.
The synonyms of the compound are 6-Mercaptonicotinic acid, 92823-43-3, 17624-07-6, 6-Mercaptopyridine-3-carboxylic acid, and 6-sulfanylidene-1H-pyridine-3-carboxylic acid.
The molecular weight of the compound is 155.18 g/mol.
The IUPAC name of the compound is 6-sulfanylidene-1H-pyridine-3-carboxylic acid.
The InChI of the compound is InChI=1S/C6H5NO2S/c8-6(9)4-1-2-5(10)7-3-4/h1-3H,(H,7,10)(H,8,9).
The InChIKey of the compound is JWWGTYCXARQFOT-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=S)NC=C1C(=O)O.
The CAS number of the compound is 17624-07-6.
The Hydrogen Bond Donor Count of the compound is 2.
Yes, the compound is canonicalized.
| [Other Products] Fluorphlogopite(Mg3K[AlF2O(SiO3)3]) Catalog: ACM12003382 CAS: 12003-38-2 |
x
Download
