What is the molecular formula of Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate?
The molecular formula is C15H13F5N2O2.
When was Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate created?
It was created on March 7, 2007.
What is the molecular weight of Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate?
The molecular weight is 348.27 g/mol.
What is the IUPAC name of Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate?
The IUPAC name is ethyl 2-amino-8-(1,1,2,2,2-pentafluoroethyl)-3H-1-benzazepine-4-carboxylate.
What is the InChIKey of Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate?
The InChIKey is ICZPANLPYRTVSF-UHFFFAOYSA-N.
What is the Canonical SMILES of Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate?
The Canonical SMILES is CCOC(=O)C1=CC2=C(C=C(C=C2)C(C(F)(F)F)(F)F)N=C(C1)N
How many hydrogen bond donor counts does Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate?
The topological polar surface area is 64.7 Ų.
How many rotatable bond counts does Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate have?
It has 4 rotatable bond counts.
Is Ethyl 2-amino-8-(perfluoroethyl)-3H-benzo[b]azepine-4-carboxylate a canonicalized compound?
Yes, it is a canonicalized compound.