What is the molecular formula of N-(4-Aminophenyl)-2-(trifluoromethyl)benzamide according to the reference?
The molecular formula is C14H11F3N2O.
When was N-(4-Aminophenyl)-2-(trifluoromethyl)benzamide created according to the reference?
It was created on November 13, 2007.
What is the molecular weight of N-(4-Aminophenyl)-2-(trifluoromethyl)benzamide?
The molecular weight is 280.24 g/mol.
What is the IUPAC name of N-(4-Aminophenyl)-2-(trifluoromethyl)benzamide?
The IUPAC name is N-(4-aminophenyl)-2-(trifluoromethyl)benzamide.
What is the Canonical SMILES representation of N-(4-Aminophenyl)-2-(trifluoromethyl)benzamide?
The Canonical SMILES is C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)N)C(F)(F)F.
How many hydrogen bond donor counts are there in N-(4-Aminophenyl)-2-(trifluoromethyl)benzamide?
There are 2 hydrogen bond donor counts.
What is the XLogP3 value of N-(4-Aminophenyl)-2-(trifluoromethyl)benzamide?
The XLogP3 value is 2.2.
How many Heavy Atoms are present in N-(4-Aminophenyl)-2-(trifluoromethyl)benzamide?
There are 20 Heavy Atoms.
Is N-(4-Aminophenyl)-2-(trifluoromethyl)benzamide a Canonicalized compound according to the reference?
Yes, it is a Canonicalized compound.
What is the InChIKey of N-(4-Aminophenyl)-2-(trifluoromethyl)benzamide?
The InChIKey is BKDOLJNIDBPTJO-UHFFFAOYSA-N.