925916-73-0 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H13BO4S.
The molecular weight of the compound is 228.08 g/mol.
The IUPAC name of the compound is [5-[(2-methylpropan-2-yl)oxycarbonyl]thiophen-2-yl]boronic acid.
The InChI of the compound is InChI=1S/C9H13BO4S/c1-9(2,3)14-8(11)6-4-5-7(15-6)10(12)13/h4-5,12-13H,1-3H3.
The InChIKey of the compound is LKQDOTUUIDJQFS-UHFFFAOYSA-N.
The canonical SMILES of the compound is B(C1=CC=C(S1)C(=O)OC(C)(C)C)(O)O.
The CAS number of the compound is 925921-29-5.
The hydrogen bond donor count of the compound is 2.
The hydrogen bond acceptor count of the compound is 5.
Yes, the compound is canonicalized.