What is the molecular formula of 6-Fluoroquinoline-2,3-dicarboxylic acid diethyl ester?
The molecular formula is C15H14FNO4.
When was 6-Fluoroquinoline-2,3-dicarboxylic acid diethyl ester created and last modified?
It was created on February 8, 2007, and last modified on December 30, 2023.
What is the IUPAC Name of 6-Fluoroquinoline-2,3-dicarboxylic acid diethyl ester?
The IUPAC Name is diethyl 6-fluoroquinoline-2,3-dicarboxylate.
What is the Canonical SMILES of 6-Fluoroquinoline-2,3-dicarboxylic acid diethyl ester?
The Canonical SMILES is CCOC(=O)C1=C(N=C2C=CC(=CC2=C1)F)C(=O)OCC.
What is the molecular weight of 6-Fluoroquinoline-2,3-dicarboxylic acid diethyl ester?
The molecular weight is 291.27 g/mol.
What is the InChIKey of 6-Fluoroquinoline-2,3-dicarboxylic acid diethyl ester?
The InChIKey is CAGDPCQGJPGFON-UHFFFAOYSA-N.
What is the XLogP3-AA value of 6-Fluoroquinoline-2,3-dicarboxylic acid diethyl ester?
The XLogP3-AA value is 3.1.
How many hydrogen bond donor counts are there in 6-Fluoroquinoline-2,3-dicarboxylic acid diethyl ester?
There are 0 hydrogen bond donor counts.
What is the topological polar surface area of 6-Fluoroquinoline-2,3-dicarboxylic acid diethyl ester?
The topological polar surface area is 65.5 Ų.
Is 6-Fluoroquinoline-2,3-dicarboxylic acid diethyl ester canonicalized?
Yes, the compound is canonicalized.