What is the molecular formula of 6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine?
The molecular formula is C15H12Cl2O2.
When was 6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine created and modified in PubChem?
It was created on July 30, 2007, and last modified on December 30, 2023.
What is the IUPAC name of 6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine?
The IUPAC name is 6-chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine.
Can you provide the InChI of 6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine?
The InChI is InChI=1S/C15H12Cl2O2/c16-8-11-6-13(17)7-12-9-18-15(19-14(11)12)10-4-2-1-3-5-10/h1-7,15H,8-9H2.
What is the molecular weight of 6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine?
The molecular weight is 295.2 g/mol.
How many hydrogen bond donor counts does 6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of 6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine?
The topological polar surface area is 18.5 Ų.
Is 6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine a canonicalized compound?
Yes, it is a canonicalized compound.
How many rotatable bond counts does 6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine have?
It has 2 rotatable bond counts.
What is the XLogP3-AA value of 6-Chloro-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxine?
The XLogP3-AA value is 4.